62936-23-6 5-Chlorovanillic acid
Ονομασία του προϊόντος |
5-Chlorovanillic acid |
Αγγλικό όνομα |
5-Chlorovanillic acid; 5-Chlorovanilic acid; 5-Chloro-4-hydroxy-3-methoxybenzoic acid; 3-chloro-4-hydroxy-5-methoxybenzoic acid |
MF |
C8H7ClO4 |
Μοριακό βάρος |
202.5918 |
InChI |
InChI=1/C8H7ClO4/c1-13-6-3-4(8(11)12)2-5(9)7(6)10/h2-3,10H,1H3,(H,11,12) |
CAS ΟΧΙ |
62936-23-6 |
EINECS |
263-766-7 |
Μοριακή δομή |
|
Πυκνότητα |
1.485g/cm3 |
Σημείο τήξης |
241-243℃ |
Σημείο βρασμού |
352.3°C at 760 mmHg |
Δείκτης διάθλασης |
1.599 |
Σημείο ανάφλεξης |
166.9°C |
Πίεση ατμών |
1.44E-05mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|