ChemNet > CAS > 6298-72-2 1,4-bis(chloromethyl)-2,5-dimethylbenzene
6298-72-2 1,4-bis(chloromethyl)-2,5-dimethylbenzene
| Ονομασία του προϊόντος |
1,4-bis(chloromethyl)-2,5-dimethylbenzene |
| Αγγλικό όνομα |
1,4-bis(chloromethyl)-2,5-dimethylbenzene; 1,4-Bis(chloromethyl)-2,5-dimethylbenzene; 2,5-Di(Chloromethyl)-p-xylene; benzene, 1,4-bis(chloromethyl)-2,5-dimethyl- |
| MF |
C10H12Cl2 |
| Μοριακό βάρος |
203.1083 |
| InChI |
InChI=1/C10H12Cl2/c1-7-3-10(6-12)8(2)4-9(7)5-11/h3-4H,5-6H2,1-2H3 |
| CAS ΟΧΙ |
6298-72-2 |
| EINECS |
228-575-5 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.145g/cm3 |
| Σημείο τήξης |
131.5-132.5℃ |
| Σημείο βρασμού |
291.5°C at 760 mmHg |
| Δείκτης διάθλασης |
1.537 |
| Σημείο ανάφλεξης |
142.2°C |
| Πίεση ατμών |
0.0034mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R34:Causes burns.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
