ChemNet > CAS > 6324-11-4 (2-hydroxyphenoxy)acetic acid
6324-11-4 (2-hydroxyphenoxy)acetic acid
| Ονομασία του προϊόντος |
(2-hydroxyphenoxy)acetic acid |
| Αγγλικό όνομα |
(2-hydroxyphenoxy)acetic acid; 2-Hydroxyphenoxyacetic acid |
| MF |
C8H8O4 |
| Μοριακό βάρος |
168.1467 |
| InChI |
InChI=1/C8H8O4/c9-6-3-1-2-4-7(6)12-5-8(10)11/h1-4,9H,5H2,(H,10,11) |
| CAS ΟΧΙ |
6324-11-4 |
| EINECS |
228-684-8 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.367g/cm3 |
| Σημείο τήξης |
138-141℃ |
| Σημείο βρασμού |
339.6°C at 760 mmHg |
| Δείκτης διάθλασης |
1.581 |
| Σημείο ανάφλεξης |
143°C |
| Πίεση ατμών |
3.52E-05mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
