ChemNet > CAS > 6326-83-6 Bis(carboxymethyl) trithiocarbonate
6326-83-6 Bis(carboxymethyl) trithiocarbonate
| Ονομασία του προϊόντος |
Bis(carboxymethyl) trithiocarbonate |
| Αγγλικό όνομα |
Bis(carboxymethyl) trithiocarbonate; 3,5-dithia-4-thioxo-1,7-heptanedioic acid; 2,2'-(carbonothioyldisulfanediyl)diacetic acid; 2,2'-(carbonothioyldisulfanediyl)diacetate |
| MF |
C5H4O4S3 |
| Μοριακό βάρος |
224.279 |
| InChI |
InChI=1/C5H6O4S3/c6-3(7)1-11-5(10)12-2-4(8)9/h1-2H2,(H,6,7)(H,8,9)/p-2 |
| CAS ΟΧΙ |
6326-83-6 |
| EINECS |
228-693-7 |
| Μοριακή δομή |
|
| Σημείο τήξης |
170-175℃ |
| Σημείο βρασμού |
532.5°C at 760 mmHg |
| Σημείο ανάφλεξης |
275.9°C |
| Πίεση ατμών |
9.26E-13mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
|
| Περιγραφή της ασφάλειας |
S24/25:Avoid contact with skin and eyes.;
|
|
