ChemNet > CAS > 6485-55-8 cis-2,6-Dimethylmorpholine
6485-55-8 cis-2,6-Dimethylmorpholine
| Ονομασία του προϊόντος |
cis-2,6-Dimethylmorpholine |
| Αγγλικό όνομα |
cis-2,6-Dimethylmorpholine; (2R,6S)-2,6-dimethylmorpholin-4-ium |
| MF |
C6H14NO |
| Μοριακό βάρος |
116.1809 |
| InChI |
InChI=1/C6H13NO/c1-5-3-7-4-6(2)8-5/h5-7H,3-4H2,1-2H3/p+1/t5-,6+ |
| CAS ΟΧΙ |
6485-55-8 |
| EINECS |
229-353-0 |
| Μοριακή δομή |
|
| Σημείο βρασμού |
146.6°C at 760 mmHg |
| Σημείο ανάφλεξης |
48.9°C |
| Πίεση ατμών |
4.6mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R10:Flammable.;
R21:Harmful in contact with skin.;
R37/38:Irritating to respiratory system and skin.;
R41:Risks of serious damage to eyes.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
