ChemNet > CAS > 660425-16-1 2-Bromo-3,5-difluoropyridine
660425-16-1 2-Bromo-3,5-difluoropyridine
Ονομασία του προϊόντος |
2-Bromo-3,5-difluoropyridine |
Αγγλικό όνομα |
2-Bromo-3,5-difluoropyridine; |
MF |
C5H2BrF2N |
Μοριακό βάρος |
193.97 |
InChI |
InChI=1/C5H2BrF2N/c6-5-4(8)1-3(7)2-9-5/h1-2H |
CAS ΟΧΙ |
660425-16-1 |
Μοριακή δομή |
|
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|