ChemNet > CAS > 69225-59-8 1,4-cyclohexanedione mono-2,2-dimethyl-trimethyle
69225-59-8 1,4-cyclohexanedione mono-2,2-dimethyl-trimethyle
| Ονομασία του προϊόντος |
1,4-cyclohexanedione mono-2,2-dimethyl-trimethyle |
| Αγγλικό όνομα |
1,4-cyclohexanedione mono-2,2-dimethyl-trimethyle; 1,4-Cyclohexanedione mono-2,2-dimethyltrimethylene ketal; 3,3-dimethyl-1,5-dioxaspiro(5.5)undecan-9-one; 3,3-Dimethyl-1,5-dioxaspiro[5.5]undecan-8-one; 3,3-Dimethyl-1,5-dioxaspiro[5.5]undecan-9-one; 1,4-Cyclohexanedione Mono(2,2-Dimethyltrimethylene Ketal) |
| MF |
C11H18O3 |
| Μοριακό βάρος |
198.2588 |
| InChI |
InChI=1/C11H18O3/c1-10(2)7-13-11(14-8-10)5-3-9(12)4-6-11/h3-8H2,1-2H3 |
| CAS ΟΧΙ |
69225-59-8 |
| EINECS |
273-918-4 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.08g/cm3 |
| Σημείο τήξης |
45-50℃ |
| Σημείο βρασμού |
295.4°C at 760 mmHg |
| Δείκτης διάθλασης |
1.484 |
| Σημείο ανάφλεξης |
123.3°C |
| Πίεση ατμών |
0.00153mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
|
| Περιγραφή της ασφάλειας |
S24/25:Avoid contact with skin and eyes.;
|
|
