ChemNet > CAS > 698-90-8 cyclohexylurea
698-90-8 cyclohexylurea
Ονομασία του προϊόντος |
cyclohexylurea |
Αγγλικό όνομα |
cyclohexylurea; N-CYCLOHEXLUREA; 1-Cyclohexylurea; N-Cyclohexylurea; Cyclohexyl-ure |
MF |
C7H14N2O |
Μοριακό βάρος |
142.1989 |
InChI |
InChI=1/C7H14N2O/c8-7(10)9-6-4-2-1-3-5-6/h6H,1-5H2,(H3,8,9,10) |
CAS ΟΧΙ |
698-90-8 |
EINECS |
211-822-6 |
Μοριακή δομή |
|
Πυκνότητα |
1.05g/cm3 |
Σημείο βρασμού |
240.3°C at 760 mmHg |
Δείκτης διάθλασης |
1.5 |
Σημείο ανάφλεξης |
99.2°C |
Πίεση ατμών |
0.0381mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
|
Περιγραφή της ασφάλειας |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|