ChemNet > CAS > 73357-18-3 4,5-Dimethoxy-2-nitrophenylacetic acid
73357-18-3 4,5-Dimethoxy-2-nitrophenylacetic acid
| Ονομασία του προϊόντος |
4,5-Dimethoxy-2-nitrophenylacetic acid |
| Αγγλικό όνομα |
4,5-Dimethoxy-2-nitrophenylacetic acid; 2-(4,5-Dimethoxy-2-nitrophenyl)acetic acid; (4,5-dimethoxy-2-nitrophenyl)acetate |
| MF |
C10H10NO6 |
| Μοριακό βάρος |
240.19 |
| InChI |
InChI=1/C10H11NO6/c1-16-8-3-6(4-10(12)13)7(11(14)15)5-9(8)17-2/h3,5H,4H2,1-2H3,(H,12,13)/p-1 |
| CAS ΟΧΙ |
73357-18-3 |
| Μοριακή δομή |
|
| Σημείο τήξης |
206-208℃ |
| Σημείο βρασμού |
433.4°C at 760 mmHg |
| Σημείο ανάφλεξης |
215.9°C |
| Πίεση ατμών |
2.79E-08mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
 Xi:Irritant;
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
