ChemNet > CAS > 74246-64-3 1,3-Thiazolin-4-one-2-acetonitrile
74246-64-3 1,3-Thiazolin-4-one-2-acetonitrile
Ονομασία του προϊόντος |
1,3-Thiazolin-4-one-2-acetonitrile |
Αγγλικό όνομα |
1,3-Thiazolin-4-one-2-acetonitrile; 2-(4-Oxo-4,5-dihydro-1,3-thiazol-2-yl)acetonitrile; (4-oxo-4,5-dihydro-1,3-thiazol-2-yl)acetonitrile |
MF |
C5H4N2OS |
Μοριακό βάρος |
140.1631 |
InChI |
InChI=1/C5H4N2OS/c6-2-1-5-7-4(8)3-9-5/h1,3H2 |
CAS ΟΧΙ |
74246-64-3 |
Μοριακή δομή |
|
Πυκνότητα |
1.43g/cm3 |
Σημείο τήξης |
185℃ |
Σημείο βρασμού |
300.6°C at 760 mmHg |
Δείκτης διάθλασης |
1.675 |
Σημείο ανάφλεξης |
135.6°C |
Πίεση ατμών |
0.00111mmHg at 25°C |
Σύμβολα επικινδυνότητας |
Xn:Harmful;
|
Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Περιγραφή της ασφάλειας |
S36/37:Wear suitable protective clothing and gloves.;
|
|