7581-97-7 2,3-Dichlorobutane
Ονομασία του προϊόντος |
2,3-Dichlorobutane |
Αγγλικό όνομα |
2,3-Dichlorobutane; 2,3-Dichlorobutane,mixture of dl and meso; 2,3-Dichlorobutane- dl + meso; (2S,3S)-2,3-dichlorobutane |
MF |
C4H8Cl2 |
Μοριακό βάρος |
127.0123 |
InChI |
InChI=1/C4H8Cl2/c1-3(5)4(2)6/h3-4H,1-2H3/t3-,4-/m0/s1 |
CAS ΟΧΙ |
7581-97-7 |
EINECS |
231-486-4 |
Μοριακή δομή |
|
Πυκνότητα |
1.076g/cm3 |
Σημείο τήξης |
-80℃ |
Σημείο βρασμού |
110.467°C at 760 mmHg |
Δείκτης διάθλασης |
1.425 |
Σημείο ανάφλεξης |
18.333°C |
Πίεση ατμών |
27.87mmHg at 25°C |
Σύμβολα επικινδυνότητας |
F:Highly flammable;
|
Κινδύνου Κώδικες |
R11:Highly flammable.;
|
Περιγραφή της ασφάλειας |
S16:Keep away from sources of ignition - No smoking.;
|
|