ChemNet > CAS > 76989-89-4 Cyanourea, sodium salt
76989-89-4 Cyanourea, sodium salt
| Ονομασία του προϊόντος |
Cyanourea, sodium salt |
| Αγγλικό όνομα |
Cyanourea, sodium salt; Cyanourea sodium salt; Cyanoisourea sodium salt; 1-cyanourea; sodium N'-cyanoimidocarbamate |
| MF |
C2H2N3NaO |
| Μοριακό βάρος |
107.0465 |
| InChI |
InChI=1/C2H3N3O.Na/c3-1-5-2(4)6;/h(H3,4,5,6);/q;+1/p-1 |
| CAS ΟΧΙ |
76989-89-4 |
| EINECS |
278-584-3 |
| Μοριακή δομή |
|
| Σημείο τήξης |
300℃ |
| Σημείο βρασμού |
263.3°C at 760 mmHg |
| Σημείο ανάφλεξης |
113.1°C |
| Πίεση ατμών |
0.00146mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
 Xn:Harmful;
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Περιγραφή της ασφάλειας |
S24/25:Avoid contact with skin and eyes.;
|
|
