771-97-1 2,3-Diaminonaphthalene
Ονομασία του προϊόντος |
2,3-Diaminonaphthalene |
Αγγλικό όνομα |
2,3-Diaminonaphthalene; 2,3-Naphthalenediamine; naphthalene-2,3-diamine |
MF |
C10H10N2 |
Μοριακό βάρος |
158.1998 |
InChI |
InChI=1/C10H10N2/c11-9-5-7-3-1-2-4-8(7)6-10(9)12/h1-6H,11-12H2 |
CAS ΟΧΙ |
771-97-1 |
EINECS |
212-241-0 |
Μοριακή δομή |
|
Πυκνότητα |
1.234g/cm3 |
Σημείο τήξης |
193-199℃ |
Σημείο βρασμού |
370.6°C at 760 mmHg |
Δείκτης διάθλασης |
1.757 |
Σημείο ανάφλεξης |
212.3°C |
Πίεση ατμών |
1.1E-05mmHg at 25°C |
Σύμβολα επικινδυνότητας |
Xn:Harmful;
|
Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|