79-91-4 DL-Terebic acid
Ονομασία του προϊόντος |
DL-Terebic acid |
Αγγλικό όνομα |
DL-Terebic acid; Tetrahydro-2,2-dimethyl-5-oxo-3-furancarboxylic acid; Terebicacid; 2,2-dimethyl-5-oxotetrahydrofuran-3-carboxylic acid; Terebic acid; (3S)-2,2-dimethyl-5-oxotetrahydrofuran-3-carboxylate; (3R)-2,2-dimethyl-5-oxotetrahydrofuran-3-carboxylate |
MF |
C7H9O4 |
Μοριακό βάρος |
157.1445 |
InChI |
InChI=1/C7H10O4/c1-7(2)4(6(9)10)3-5(8)11-7/h4H,3H2,1-2H3,(H,9,10)/p-1/t4-/m0/s1 |
CAS ΟΧΙ |
79-91-4 |
EINECS |
201-233-2 |
Μοριακή δομή |
|
Σημείο τήξης |
175-180℃ |
Σημείο βρασμού |
347.6°C at 760 mmHg |
Σημείο ανάφλεξης |
148.6°C |
Πίεση ατμών |
9.29E-06mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
|
Περιγραφή της ασφάλειας |
S24/25:Avoid contact with skin and eyes.;
|
|