ChemNet > CAS > 80333-65-9 3,3',4,4'-tetrachlorobiphenyl-ul-14C
80333-65-9 3,3',4,4'-tetrachlorobiphenyl-ul-14C
Ονομασία του προϊόντος |
3,3',4,4'-tetrachlorobiphenyl-ul-14C |
Αγγλικό όνομα |
3,3',4,4'-tetrachlorobiphenyl-ul-14C;1,1'-Biphenyl, 3,3',4,4'-tetrachloro-, labeled with carbon-14; 3,3',4,4'-Tetrachloro(14C-U)biphenyl; 3,3',4,4'-Tetrachloro-1,1'-biphenyl labeled with carbon-14; 3,3',4,4'-tetrachlorobiphenyl |
MF |
C12H6Cl4 |
Μοριακό βάρος |
291.988 |
InChI |
InChI=1/C12H6Cl4/c13-9-3-1-7(5-11(9)15)8-2-4-10(14)12(16)6-8/h1-6H |
CAS ΟΧΙ |
80333-65-9 |
Μοριακή δομή |
|
Πυκνότητα |
1.441g/cm3 |
Σημείο βρασμού |
380.7°C at 760 mmHg |
Δείκτης διάθλασης |
1.612 |
Σημείο ανάφλεξης |
188.4°C |
Πίεση ατμών |
1.17E-05mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
|
Περιγραφή της ασφάλειας |
|
|