ChemNet > CAS > 81067-38-1 1-Bromo-2,3,5-trichlorobenzene
81067-38-1 1-Bromo-2,3,5-trichlorobenzene
Ονομασία του προϊόντος |
1-Bromo-2,3,5-trichlorobenzene |
Αγγλικό όνομα |
1-Bromo-2,3,5-trichlorobenzene; 2,3,5-Trichlorobromobenzene |
MF |
C6H2BrCl3 |
Μοριακό βάρος |
260.3431 |
InChI |
InChI=1/C6H2BrCl3/c7-4-1-3(8)2-5(9)6(4)10/h1-2H |
CAS ΟΧΙ |
81067-38-1 |
Μοριακή δομή |
|
Πυκνότητα |
1.84g/cm3 |
Σημείο τήξης |
58-61℃ |
Σημείο βρασμού |
270.8°C at 760 mmHg |
Δείκτης διάθλασης |
1.603 |
Σημείο ανάφλεξης |
129.3°C |
Πίεση ατμών |
0.0111mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|