ChemNet > CAS > 81156-68-5 2,4-Dichlorophenethylalcohol
81156-68-5 2,4-Dichlorophenethylalcohol
| Ονομασία του προϊόντος |
2,4-Dichlorophenethylalcohol |
| Αγγλικό όνομα |
2,4-Dichlorophenethylalcohol; 2-(2,4-Dichlorophenyl)-ethanol; 2,4-dichlorophenethyl alcohol; 2-(2,4-Dichlorophenyl)ethanol |
| MF |
C8H8Cl2O |
| Μοριακό βάρος |
191.0545 |
| InChI |
InChI=1/C8H8Cl2O/c9-7-2-1-6(3-4-11)8(10)5-7/h1-2,5,11H,3-4H2 |
| CAS ΟΧΙ |
81156-68-5 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.329g/cm3 |
| Σημείο βρασμού |
276.6°C at 760 mmHg |
| Δείκτης διάθλασης |
1.569 |
| Σημείο ανάφλεξης |
117.2°C |
| Πίεση ατμών |
0.00229mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
|
| Περιγραφή της ασφάλειας |
S24/25:Avoid contact with skin and eyes.;
|
|
