ChemNet > CAS > 84365-55-9 Trichloro(indenyl)titanium(IV)
84365-55-9 Trichloro(indenyl)titanium(IV)
| Ονομασία του προϊόντος |
Trichloro(indenyl)titanium(IV) |
| Αγγλικό όνομα |
Trichloro(indenyl)titanium(IV); Indenyltitaniumtrichloride; trichloro(1H-inden-1-yl)titanium |
| MF |
C9H7Cl3Ti |
| Μοριακό βάρος |
269.3779 |
| InChI |
InChI=1/C9H7.3ClH.Ti/c1-2-5-9-7-3-6-8(9)4-1;;;;/h1-7H;3*1H;/q;;;;+3/p-3/rC9H7Cl3Ti/c10-13(11,12)9-6-5-7-3-1-2-4-8(7)9/h1-6,9H |
| CAS ΟΧΙ |
84365-55-9 |
| Μοριακή δομή |
|
| Σημείο τήξης |
162℃ |
| Σύμβολα επικινδυνότητας |
 Xi:Irritant;
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
