9009-54-5 Polyurethane
Ονομασία του προϊόντος |
Polyurethane |
Αγγλικό όνομα |
Polyurethane; Polyurethane foam; Polyurethane foams; Polyisocyanurate resins; Polyurethanes, cellular; PU foam; The following companies react isocyanates or prepolymers with polyols to produce polyurethane foams. The list is incomplete.; POLYURETHANEOLIGOMERS; POLYURETHANEVARNISH; PU; Acrylic polyurethane paint; Acrylic polyurethane anticorrosive coating; Polyurethane mixed component; 1-ethylurea |
MF |
C3H8N2O |
Μοριακό βάρος |
88.1084 |
InChI |
InChI=1/C3H8N2O/c1-2-5-3(4)6/h2H2,1H3,(H3,4,5,6) |
CAS ΟΧΙ |
9009-54-5 |
EINECS |
210-898-8 |
Μοριακή δομή |
|
Πυκνότητα |
1.005g/cm3 |
Σημείο βρασμού |
136.3°C at 760 mmHg |
Δείκτης διάθλασης |
1.44 |
Σημείο ανάφλεξης |
36.2°C |
Πίεση ατμών |
7.44mmHg at 25°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
|
Περιγραφή της ασφάλειας |
|
|