ChemNet > CAS > 90259-31-7 2-Bromo-6-methylbenzoic acid
90259-31-7 2-Bromo-6-methylbenzoic acid
Ονομασία του προϊόντος |
2-Bromo-6-methylbenzoic acid |
Αγγλικό όνομα |
2-Bromo-6-methylbenzoic acid; 6-Bromo-o-toluic acid |
MF |
C8H7BrO2 |
Μοριακό βάρος |
215.044 |
InChI |
InChI=1/C8H7BrO2/c1-5-3-2-4-6(9)7(5)8(10)11/h2-4H,1H3,(H,10,11) |
CAS ΟΧΙ |
90259-31-7 |
Μοριακή δομή |
|
Πυκνότητα |
1.6g/cm3 |
Σημείο τήξης |
108-112℃ |
Σημείο βρασμού |
307.043°C at 760 mmHg |
Δείκτης διάθλασης |
1.595 |
Σημείο ανάφλεξης |
139.495°C |
Πίεση ατμών |
0mmHg at 25°C |
Σύμβολα επικινδυνότητας |
Xn:Harmful;
|
Κινδύνου Κώδικες |
R22:;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|