ChemNet > CAS > 923-06-8 DL-Bromosuccinic acid
923-06-8 DL-Bromosuccinic acid
| Ονομασία του προϊόντος |
DL-Bromosuccinic acid |
| Αγγλικό όνομα |
DL-Bromosuccinic acid; Bromobutanedioic acid; Bromosuccinic Acid; 2-bromobutanedioic acid; (2R)-2-bromobutanedioate; (2S)-2-bromobutanedioate; 2-Bromosuccinic acid |
| MF |
C4H3BrO4 |
| Μοριακό βάρος |
194.9693 |
| InChI |
InChI=1/C4H5BrO4/c5-2(4(8)9)1-3(6)7/h2H,1H2,(H,6,7)(H,8,9)/p-2/t2-/m0/s1 |
| CAS ΟΧΙ |
923-06-8 |
| EINECS |
213-087-7 |
| Μοριακή δομή |
|
| Σημείο τήξης |
160-162℃ |
| Σημείο βρασμού |
255.1°C at 760 mmHg |
| Σημείο ανάφλεξης |
108.1°C |
| Πίεση ατμών |
0.00512mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
 Xi:Irritant;
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
