ChemNet > CAS > 100859-84-5 2-Chloro isonicotinamide
100859-84-5 2-Chloro isonicotinamide
| termék neve |
2-Chloro isonicotinamide |
| Angol név |
2-Chloro isonicotinamide;6-methyl-5-nitropyridin-2(1H)-one; 2-chloropyridine-4-carboxamide |
| MF |
C6H5ClN2O |
| Molekulatömeg |
156.5697 |
| InChI |
InChI=1/C6H5ClN2O/c7-5-3-4(6(8)10)1-2-9-5/h1-3H,(H2,8,10) |
| CAS-szám |
100859-84-5 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.381g/cm3 |
| Olvadáspont |
193℃ |
| Forráspont |
312.2°C at 760 mmHg |
| Törésmutató |
1.588 |
| Gyulladáspont |
142.6°C |
| Gőznyomás |
0.000535mmHg at 25°C |
| Veszély szimbólumok |
 Xi:Irritant;
|
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
