ChemNet > CAS > 1013-25-8 1-(2,5-Dimethylphenyl)piperazine
1013-25-8 1-(2,5-Dimethylphenyl)piperazine
| termék neve |
1-(2,5-Dimethylphenyl)piperazine |
| Angol név |
1-(2,5-Dimethylphenyl)piperazine;1-(2,5-Xylyl)piperazine; 4-(2,5-dimethylphenyl)piperazin-1-ium |
| MF |
C12H19N2 |
| Molekulatömeg |
191.2921 |
| InChI |
InChI=1/C12H18N2/c1-10-3-4-11(2)12(9-10)14-7-5-13-6-8-14/h3-4,9,13H,5-8H2,1-2H3/p+1 |
| CAS-szám |
1013-25-8 |
| EINECS |
213-795-6 |
| Molekuláris szerkezete |
|
| Olvadáspont |
42-46℃ |
| Forráspont |
332.5°C at 760 mmHg |
| Gyulladáspont |
151.7°C |
| Gőznyomás |
0.000146mmHg at 25°C |
| Veszély szimbólumok |
 Xi:Irritant;
|
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|
