ChemNet > CAS > 10241-97-1 5-methylindole-2-carboxylic acid
10241-97-1 5-methylindole-2-carboxylic acid
termék neve |
5-methylindole-2-carboxylic acid |
Angol név |
5-methylindole-2-carboxylic acid; 5-methyl-1H-indole-2-carboxylic acid |
MF |
C10H9NO2 |
Molekulatömeg |
175.184 |
InChI |
InChI=1/C10H9NO2/c1-6-2-3-8-7(4-6)5-9(11-8)10(12)13/h2-5,11H,1H3,(H,12,13) |
CAS-szám |
10241-97-1 |
Molekuláris szerkezete |
|
Sűrűség |
1.34g/cm3 |
Forráspont |
421.2°C at 760 mmHg |
Törésmutató |
1.696 |
Gyulladáspont |
208.5°C |
Gőznyomás |
7.58E-08mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|