103-94-6 4-Nitrophenyloxamic acid

termék neve	4-Nitrophenyloxamic acid
Angol név	4-Nitrophenyloxamic acid; 4-Nitrooxanilic acid; [(4-nitrophenyl)amino](oxo)acetic acid
MF	C₈H₆N₂O₅
Molekulatömeg	210.1436
InChI	InChI=1/C8H6N2O5/c11-7(8(12)13)9-5-1-3-6(4-2-5)10(14)15/h1-4H,(H,9,11)(H,12,13)
CAS-szám	103-94-6
EINECS	203-160-1
Molekuláris szerkezete
Sűrűség	1.629g/cm³
Törésmutató	1.678
Veszély szimbólumok
Kockázatot kódok	R36/37/38:Irritating to eyes, respiratory system and skin.;
Biztonsági Leírás	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;