ChemNet > CAS > 104776-74-1 ethyl 5-(2-bromoacetyl)isoxazole-3-carboxylate
104776-74-1 ethyl 5-(2-bromoacetyl)isoxazole-3-carboxylate
| termék neve |
ethyl 5-(2-bromoacetyl)isoxazole-3-carboxylate |
| Angol név |
ethyl 5-(2-bromoacetyl)isoxazole-3-carboxylate;ethyl 5-(bromoacetyl)isoxazole-3-carboxylate |
| MF |
C8H8BrNO4 |
| Molekulatömeg |
262.0574 |
| InChI |
InChI=1/C8H8BrNO4/c1-2-13-8(12)5-3-7(14-10-5)6(11)4-9/h3H,2,4H2,1H3 |
| CAS-szám |
104776-74-1 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.592g/cm3 |
| Olvadáspont |
71℃ |
| Forráspont |
374.2°C at 760 mmHg |
| Törésmutató |
1.529 |
| Gyulladáspont |
180.1°C |
| Gőznyomás |
8.52E-06mmHg at 25°C |
| Veszély szimbólumok |
 C:Corrosive;
|
| Kockázatot kódok |
R34:Causes burns.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
