ChemNet > CAS > 10487-71-5 Crotonyl chloride
10487-71-5 Crotonyl chloride
| termék neve |
Crotonyl chloride |
| Angol név |
Crotonyl chloride; 2-Butenoyl chloride; But-2-enoyl chloride |
| MF |
C4H5ClO |
| Molekulatömeg |
104.5349 |
| InChI |
InChI=1/C4H5ClO/c1-2-3-4(5)6/h2-3H,1H3/b3-2- |
| CAS-szám |
10487-71-5 |
| EINECS |
234-010-3 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.081g/cm3 |
| Forráspont |
124.499°C at 760 mmHg |
| Törésmutató |
1.441 |
| Gyulladáspont |
35°C |
| Gőznyomás |
12.707mmHg at 25°C |
| Veszély szimbólumok |
 C:Corrosive;
|
| Kockázatot kódok |
R10:Flammable.;
R34:Causes burns.;
|
| Biztonsági Leírás |
S16:Keep away from sources of ignition - No smoking.;
S24/25:Avoid contact with skin and eyes.;
S28A:After contact with skin, wash immediately with plenty of water.;
|
|
