ChemNet > CAS > 10606-72-1 ethyl (R)-(-)-mandelate
10606-72-1 ethyl (R)-(-)-mandelate
| termék neve |
ethyl (R)-(-)-mandelate |
| Angol név |
ethyl (R)-(-)-mandelate; (-)-Ethyl mandelate; D-(-)-Mandelic acid ethyl ester; (R)-(-)-alpha-Hydroxyphenylacetic acid ethyl ester~(R)-(-)-Mandelic acid ethyl ester; ethyl (2R)-hydroxy(phenyl)ethanoate |
| MF |
C10H12O3 |
| Molekulatömeg |
180.2005 |
| InChI |
InChI=1/C10H12O3/c1-2-13-10(12)9(11)8-6-4-3-5-7-8/h3-7,9,11H,2H2,1H3/t9-/m1/s1 |
| CAS-szám |
10606-72-1 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.147g/cm3 |
| Olvadáspont |
33-34℃ |
| Forráspont |
254°C at 760 mmHg |
| Törésmutató |
1.528 |
| Gyulladáspont |
118.1°C |
| Gőznyomás |
0.00918mmHg at 25°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
|
| Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|
