ChemNet > CAS > 106070-58-0 2,5-Diamino-3-picoline
106070-58-0 2,5-Diamino-3-picoline
| termék neve |
2,5-Diamino-3-picoline |
| Angol név |
2,5-Diamino-3-picoline;3-methylpyridine-2,5-diamine; 2,5-diamino-3-methylpyridinium |
| MF |
C6H10N3 |
| Molekulatömeg |
124.1632 |
| InChI |
InChI=1/C6H9N3/c1-4-2-5(7)3-9-6(4)8/h2-3H,7H2,1H3,(H2,8,9)/p+1 |
| CAS-szám |
106070-58-0 |
| Molekuláris szerkezete |
|
| Forráspont |
329.2°C at 760 mmHg |
| Gyulladáspont |
179.2°C |
| Gőznyomás |
0.00018mmHg at 25°C |
| Veszély szimbólumok |
 Xi:Irritant;
|
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
