ChemNet > CAS > 1141-23-7 3-(4-Chlorophenyl)glutaramic acid
1141-23-7 3-(4-Chlorophenyl)glutaramic acid
termék neve |
3-(4-Chlorophenyl)glutaramic acid |
Angol név |
3-(4-Chlorophenyl)glutaramic acid; 3-(4-Chloro phenyl) Glutaric acid monoamide; 5-amino-3-(4-chlorophenyl)-5-oxopentanoic acid; β-(4-chlorophenyl)Glutarimide |
MF |
C11H12ClNO3 |
Molekulatömeg |
241.6709 |
InChI |
InChI=1/C11H12ClNO3/c12-9-3-1-7(2-4-9)8(5-10(13)14)6-11(15)16/h1-4,8H,5-6H2,(H2,13,14)(H,15,16) |
CAS-szám |
1141-23-7 |
Molekuláris szerkezete |
|
Sűrűség |
1.343g/cm3 |
Forráspont |
494.9°C at 760 mmHg |
Törésmutató |
1.578 |
Gyulladáspont |
253.1°C |
Gőznyomás |
1.3E-10mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|