117-34-0 Diphenylacetic acid
termék neve |
Diphenylacetic acid |
Angol név |
Diphenylacetic acid; Benzeneacetic acid, alpha-phenyl-; 2,2-Diphenylacetic Acid |
MF |
C14H12O2 |
Molekulatömeg |
212.2439 |
InChI |
InChI=1/C14H12O2/c15-14(16)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13H,(H,15,16) |
CAS-szám |
117-34-0 |
EINECS |
204-185-0 |
Molekuláris szerkezete |
|
Sűrűség |
1.174g/cm3 |
Olvadáspont |
147-149℃ |
Forráspont |
285°C at 760 mmHg |
Törésmutató |
1.599 |
Gyulladáspont |
140.4°C |
Gőznyomás |
0.00135mmHg at 25°C |
Veszély szimbólumok |
Xi:Irritant;
|
Kockázatot kódok |
R36/38:Irritating to eyes and skin.;
|
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|