ChemNet > CAS > 118-76-3 Rhodizonic acid dihydrate
118-76-3 Rhodizonic acid dihydrate
termék neve |
Rhodizonic acid dihydrate |
Angol név |
Rhodizonic acid dihydrate; 5,6-dihydroxycyclohex-5-ene-1,2,3,4-tetraone; Rhodizonic acid; 1,2-Dihydroxy-3,4,5,6-tetraoxocyclohexene; 5,6-dihydroxycyclohex-5-ene-1,2,3,4-tetrone; 5,6-dihydroxycyclohex-5-ene-1,2,3,4-tetrone dihydrate |
MF |
C6H6O8 |
Molekulatömeg |
206.107 |
InChI |
InChI=1/C6H2O6.2H2O/c7-1-2(8)4(10)6(12)5(11)3(1)9;;/h7-8H;2*1H2 |
CAS-szám |
118-76-3 |
EINECS |
204-276-5 |
Molekuláris szerkezete |
|
Olvadáspont |
255-257℃ |
Forráspont |
346.7°C at 760 mmHg |
Gyulladáspont |
177.7°C |
Gőznyomás |
3.5E-06mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|