ChemNet > CAS > 1190-92-7 1-Dimethylamino-2-nitroethylene
1190-92-7 1-Dimethylamino-2-nitroethylene
| termék neve |
1-Dimethylamino-2-nitroethylene |
| Angol név |
1-Dimethylamino-2-nitroethylene; 1-(dimethylamino)-2-nitroethylene; (E)-N,N-dimethyl-2-nitroethenamine; 1-Nitro-2-(dimethylamino)ethylene |
| MF |
C4H8N2O2 |
| Molekulatömeg |
116.1185 |
| InChI |
InChI=1/C4H8N2O2/c1-5(2)3-4-6(7)8/h3-4H,1-2H3/b4-3+ |
| CAS-szám |
1190-92-7 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.073g/cm3 |
| Forráspont |
161.1°C at 760 mmHg |
| Törésmutató |
1.473 |
| Gyulladáspont |
51.2°C |
| Gőznyomás |
2.31mmHg at 25°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
