ChemNet > CAS > 119584-70-2 2,4-Diamino-5-fluoroquinazoline
119584-70-2 2,4-Diamino-5-fluoroquinazoline
| termék neve |
2,4-Diamino-5-fluoroquinazoline |
| Angol név |
2,4-Diamino-5-fluoroquinazoline; 5-Fluoroquinazoline-2,4-diamine |
| MF |
C8H7FN4 |
| Molekulatömeg |
178.1664 |
| InChI |
InChI=1/C8H7FN4/c9-4-2-1-3-5-6(4)7(10)13-8(11)12-5/h1-3H,(H4,10,11,12,13) |
| CAS-szám |
119584-70-2 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.5g/cm3 |
| Forráspont |
463.1°C at 760 mmHg |
| Törésmutató |
1.757 |
| Gyulladáspont |
233.9°C |
| Gőznyomás |
9.34E-09mmHg at 25°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
