ChemNet > CAS > 120-22-9 N,N-Diethyl-4-nitrosoaniline
120-22-9 N,N-Diethyl-4-nitrosoaniline
| termék neve |
N,N-Diethyl-4-nitrosoaniline |
| Angol név |
N,N-Diethyl-4-nitrosoaniline; 4-Nitroso-N,N-diethylaniline |
| MF |
C10H14N2O |
| Molekulatömeg |
178.231 |
| InChI |
InChI=1/C10H14N2O/c1-3-12(4-2)10-7-5-9(11-13)6-8-10/h5-8H,3-4H2,1-2H3 |
| CAS-szám |
120-22-9 |
| EINECS |
204-379-5 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.01g/cm3 |
| Olvadáspont |
81-85℃ |
| Forráspont |
290.3°C at 760 mmHg |
| Törésmutató |
1.52 |
| Gyulladáspont |
129.4°C |
| Gőznyomás |
0.00208mmHg at 25°C |
| Veszély szimbólumok |
 T:Toxic;
|
| Kockázatot kódok |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
|
| Biztonsági Leírás |
S28A:After contact with skin, wash immediately with plenty of water.;
S37:Wear suitable gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
