13221-86-8 2,4-Dihydroxybenzhydrazide

termék neve	2,4-Dihydroxybenzhydrazide
Angol név	2,4-Dihydroxybenzhydrazide; 2,4-Dihydroxybenzoic acid,hydrazide; 2,4-dihydroxybenzohydrazide
MF	C₇H₈N₂O₃
Molekulatömeg	168.15
InChI	InChI=1/C7H8N2O3/c8-9-7(12)5-2-1-4(10)3-6(5)11/h1-3,10-11H,8H2,(H,9,12)
CAS-szám	13221-86-8
Molekuláris szerkezete
Sűrűség	1.477g/cm³
Olvadáspont	247-250℃
Törésmutató	1.67
Veszély szimbólumok
Kockázatot kódok	R36/37/38:Irritating to eyes, respiratory system and skin.;
Biztonsági Leírás	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;