ChemNet > CAS > 132898-95-4 2,2'-bitiofén-5-bórsav
132898-95-4 2,2'-bitiofén-5-bórsav
termék neve |
2,2'-bitiofén-5-bórsav |
Szinonimák |
2,2'-bitiofén-5-ilbórsav |
Angol név |
2,2'-bithiophene-5-boronic acid;2,2'-bithiophen-5-ylboronic acid |
MF |
C8H7BO2S2 |
Molekulatömeg |
210.081 |
InChI |
InChI=1/C8H7BO2S2/c10-9(11)8-4-3-7(13-8)6-2-1-5-12-6/h1-5,10-11H |
CAS-szám |
132898-95-4 |
Molekuláris szerkezete |
|
Sűrűség |
1.42g/cm3 |
Olvadáspont |
127℃ |
Forráspont |
416.1°C at 760 mmHg |
Törésmutató |
1.658 |
Gyulladáspont |
205.5°C |
Gőznyomás |
1.14E-07mmHg at 25°C |
Veszély szimbólumok |
Xi:Irritant;
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|