ChemNet > CAS > 13294-71-8 2-Bromo-2-butene, mixture of cis and trans
13294-71-8 2-Bromo-2-butene, mixture of cis and trans
| termék neve |
2-Bromo-2-butene, mixture of cis and trans |
| Angol név |
2-Bromo-2-butene, mixture of cis and trans; 2-Bromo-2-butene (cis+trans); Bromobutenecistrans; 2-Bromo-2-butene; 2-bromobut-2-ene; (2Z)-2-bromobut-2-ene; (2E)-2-bromobut-2-ene |
| MF |
C4H7Br |
| Molekulatömeg |
135.0024 |
| InChI |
InChI=1/C4H7Br/c1-3-4(2)5/h3H,1-2H3/b4-3+ |
| CAS-szám |
13294-71-8 |
| EINECS |
236-316-2 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.334g/cm3 |
| Forráspont |
93.9°C at 760 mmHg |
| Törésmutató |
1.469 |
| Gyulladáspont |
13.6°C |
| Gőznyomás |
55.2mmHg at 25°C |
| Veszély szimbólumok |
 F:Highly flammable;
|
| Kockázatot kódok |
R11:Highly flammable.;
|
| Biztonsági Leírás |
S16:Keep away from sources of ignition - No smoking.;
|
|
