ChemNet > CAS > 14064-83-6 4-hidroxi-4'-nitrosztilbén
14064-83-6 4-hidroxi-4'-nitrosztilbén
| termék neve |
4-hidroxi-4'-nitrosztilbén |
| Szinonimák |
; 4-[2-(nitrofenil)etenil]fenol; 4-[2-(4-nitrofenil)etenil]fenol; 4-[(E)-2-(4-nitrofenil)etenil]fenol |
| Angol név |
4-Hydroxy-4'-nitrostilbene; 4-[2-(Nitrophenyl)ethenyl]phenol; 4-[2-(4-nitrophenyl)ethenyl]phenol; 4-[(E)-2-(4-nitrophenyl)ethenyl]phenol |
| MF |
C14H11NO3 |
| Molekulatömeg |
241.242 |
| InChI |
InChI=1/C14H11NO3/c16-14-9-5-12(6-10-14)2-1-11-3-7-13(8-4-11)15(17)18/h1-10,16H/b2-1+ |
| CAS-szám |
14064-83-6 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.318g/cm3 |
| Forráspont |
389.8°C at 760 mmHg |
| Törésmutató |
1.717 |
| Gyulladáspont |
164.5°C |
| Gőznyomás |
1.23E-06mmHg at 25°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
