ChemNet > CAS > 141134-24-9 4-(difluor-metoxi)fenacil-bromid
141134-24-9 4-(difluor-metoxi)fenacil-bromid
| termék neve |
4-(difluor-metoxi)fenacil-bromid |
| Szinonimák |
; 2-Bróm-1-[4-(difluormetoxi)fenil]etán-1-on; 2-bróm-1-[4-(difluormetoxi)fenil]etanon |
| Angol név |
4-(difluoromethoxy)phenacyl bromide; 2-Bromo-1-[4-(difluoromethoxy)phenyl]ethan-1-one; 2-bromo-1-[4-(difluoromethoxy)phenyl]ethanone |
| MF |
C9H7BrF2O2 |
| Molekulatömeg |
265.0515 |
| InChI |
InChI=1/C9H7BrF2O2/c10-5-8(13)6-1-3-7(4-2-6)14-9(11)12/h1-4,9H,5H2 |
| CAS-szám |
141134-24-9 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.564g/cm3 |
| Olvadáspont |
66-68℃ |
| Forráspont |
301.9°C at 760 mmHg |
| Törésmutató |
1.513 |
| Gyulladáspont |
136.4°C |
| Gőznyomás |
0.00102mmHg at 25°C |
| Veszély szimbólumok |
C:Corrosive;
|
| Kockázatot kódok |
R34:Causes burns.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|