ChemNet > CAS > 144284-25-3 2,4,5-trifluorobenzyl alcohol
144284-25-3 2,4,5-trifluorobenzyl alcohol
termék neve |
2,4,5-trifluorobenzyl alcohol |
Angol név |
2,4,5-trifluorobenzyl alcohol; (2,4,5-trifluorophenyl)methanol |
MF |
C7H5F3O |
Molekulatömeg |
162.11 |
InChI |
InChI=1/C6H3BrF2O/c7-3-1-2-4(10)6(9)5(3)8/h1-2,10H |
CAS-szám |
144284-25-3 |
Molekuláris szerkezete |
|
Sűrűség |
1.858g/cm3 |
Forráspont |
213.308°C at 760 mmHg |
Törésmutató |
1.55 |
Gyulladáspont |
82.806°C |
Gőznyomás |
0.113mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/38:Irritating to eyes and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|