ChemNet > CAS > 1444-65-1 2-Phenylcyclohexanone
1444-65-1 2-Phenylcyclohexanone
| termék neve |
2-Phenylcyclohexanone |
| Angol név |
2-Phenylcyclohexanone;AI3-07036; Cyclohexanone, 2-phenyl-; (2S)-2-phenylcyclohexanone; (2R)-2-phenylcyclohexanone |
| MF |
C12H14O |
| Molekulatömeg |
174.239 |
| InChI |
InChI=1/C12H14O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-3,6-7,11H,4-5,8-9H2/t11-/m1/s1 |
| CAS-szám |
1444-65-1 |
| EINECS |
215-888-7 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.042g/cm3 |
| Olvadáspont |
56-59℃ |
| Forráspont |
294°C at 760 mmHg |
| Törésmutató |
1.537 |
| Gyulladáspont |
123.7°C |
| Gőznyomás |
0.00167mmHg at 25°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
|
| Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|
