144693-65-2 4-Ethynylbenzoic acid sodium salt

termék neve	4-Ethynylbenzoic acid sodium salt
Angol név	4-Ethynylbenzoic acid sodium salt; (4-Carboxyphenyl)acetylene sodium salt~Sodium 4-ethynylbenzoate; sodium 4-ethynylbenzoate
MF	C₉H₅NaO₂
Molekulatömeg	168.1246
InChI	InChI=1/C9H6O2.Na/c1-2-7-3-5-8(6-4-7)9(10)11;/h1,3-6H,(H,10,11);/q;+1/p-1
CAS-szám	144693-65-2
Molekuláris szerkezete
Veszély szimbólumok
Kockázatot kódok	R36/37/38:Irritating to eyes, respiratory system and skin.;
Biztonsági Leírás	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;