ChemNet > CAS > 146132-95-8 3,5,7-trihidroxi-3',4',5'-trimetoxiflavon
146132-95-8 3,5,7-trihidroxi-3',4',5'-trimetoxiflavon
termék neve |
3,5,7-trihidroxi-3',4',5'-trimetoxiflavon |
Szinonimák |
; Miricetin-trimetil-éter; 3,5,7-trihidroxi-2-(3,4,5-trimetoxifenil)-4H-kromén-4-on |
Angol név |
3,5,7-Trihydroxy-3',4',5'-trimethoxyflavone; Myricetin trimethyl ether; 3,5,7-trihydroxy-2-(3,4,5-trimethoxyphenyl)-4H-chromen-4-one |
MF |
C18H16O8 |
Molekulatömeg |
360.3148 |
InChI |
InChI=1/C18H16O8/c1-23-12-4-8(5-13(24-2)18(12)25-3)17-16(22)15(21)14-10(20)6-9(19)7-11(14)26-17/h4-7,19-20,22H,1-3H3 |
CAS-szám |
146132-95-8 |
Molekuláris szerkezete |
|
Sűrűség |
1.482g/cm3 |
Forráspont |
585.2°C at 760 mmHg |
Törésmutató |
1.658 |
Gyulladáspont |
213.9°C |
Gőznyomás |
2.71E-14mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|