ChemNet > CAS > 1502-22-3 2-(1-Cyclohexenyl)cyclohexanone
1502-22-3 2-(1-Cyclohexenyl)cyclohexanone
termék neve |
2-(1-Cyclohexenyl)cyclohexanone |
Angol név |
2-(1-Cyclohexenyl)cyclohexanone;2-(1-cyclohexen-1-yl)-Cyclohexanone |
MF |
C12H18O |
Molekulatömeg |
178.2707 |
InChI |
InChI=1/C12H18O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h6,11H,1-5,7-9H2/t11-/m1/s1 |
CAS-szám |
1502-22-3 |
EINECS |
216-120-3 |
Molekuláris szerkezete |
|
Sűrűség |
1.022g/cm3 |
Forráspont |
281.9°C at 760 mmHg |
Törésmutató |
1.521 |
Gyulladáspont |
116.1°C |
Gőznyomás |
0.00346mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|