ChemNet > CAS > 1516-17-2 2,4-Hexadienyl acetate
1516-17-2 2,4-Hexadienyl acetate
termék neve |
2,4-Hexadienyl acetate |
Angol név |
2,4-Hexadienyl acetate; trans,trans-2,4-Hexadienyl acetate; hexa-2,4-dien-1-yl acetate; (2E,4E)-hexa-2,4-dien-1-yl acetate |
MF |
C8H12O2 |
Molekulatömeg |
140.1797 |
InChI |
InChI=1/C8H12O2/c1-3-4-5-6-7-10-8(2)9/h3-6H,7H2,1-2H3/b4-3+,6-5+ |
CAS-szám |
1516-17-2 |
EINECS |
216-163-8 |
Molekuláris szerkezete |
|
Sűrűség |
0.926g/cm3 |
Forráspont |
186.5°C at 760 mmHg |
Törésmutató |
1.454 |
Gyulladáspont |
79.6°C |
Gőznyomás |
0.662mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R36:Irritating to eyes.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|