ChemNet > CAS > 15414-98-9 Trifenil-karbénium-pentaklór-sztanát
15414-98-9 Trifenil-karbénium-pentaklór-sztanát
| termék neve |
Trifenil-karbénium-pentaklór-sztanát |
| Szinonimák |
; Tritil-pentaklór-sztanát; ón(4 )-trifenilmetilium-klorid (1:1:5) |
| Angol név |
Triphenylcarbenium pentachlorostannate; Trityl pentachlorostannate; tin(4+) triphenylmethylium chloride (1:1:5) |
| MF |
C19H15Cl5Sn |
| Molekulatömeg |
539.2974 |
| InChI |
InChI=1/C19H15.5ClH.Sn/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;;;;/h1-15H;5*1H;/q+1;;;;;;+4/p-5 |
| CAS-szám |
15414-98-9 |
| EINECS |
239-426-9 |
| Molekuláris szerkezete |
|
| Veszély szimbólumok |
 C:Corrosive;
|
| Kockázatot kódok |
R34:Causes burns.;
|
| Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
|
|
