ChemNet > CAS > 15547-89-4 2-(3-Methoxyphenyl)cyclohexanone
15547-89-4 2-(3-Methoxyphenyl)cyclohexanone
termék neve |
2-(3-Methoxyphenyl)cyclohexanone |
Angol név |
2-(3-Methoxyphenyl)cyclohexanone;Cyclohexanone, 2-(3-methoxyphenyl)-; (2R)-2-(3-methoxyphenyl)cyclohexanone; (2S)-2-(3-methoxyphenyl)cyclohexanone |
MF |
C13H16O2 |
Molekulatömeg |
204.2649 |
InChI |
InChI=1/C13H16O2/c1-15-11-6-4-5-10(9-11)12-7-2-3-8-13(12)14/h4-6,9,12H,2-3,7-8H2,1H3/t12-/m0/s1 |
CAS-szám |
15547-89-4 |
EINECS |
239-602-5 |
Molekuláris szerkezete |
|
Sűrűség |
1.068g/cm3 |
Forráspont |
332.6°C at 760 mmHg |
Törésmutató |
1.528 |
Gyulladáspont |
147.8°C |
Gőznyomás |
0.000144mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|