ChemNet > CAS > 15822-77-2 1-(2-nitrophenyl)piperidine
15822-77-2 1-(2-nitrophenyl)piperidine
| termék neve |
1-(2-nitrophenyl)piperidine |
| Angol név |
1-(2-nitrophenyl)piperidine; 1-(2-Nitrophenyl)piperidine; 1-(O-Nitrophenyl)piperidine; Piperidine, 1-(2-nitrophenyl)- |
| MF |
C11H14N2O2 |
| Molekulatömeg |
206.2411 |
| InChI |
InChI=1/C11H14N2O2/c14-13(15)11-7-3-2-6-10(11)12-8-4-1-5-9-12/h2-3,6-7H,1,4-5,8-9H2 |
| CAS-szám |
15822-77-2 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.188g/cm3 |
| Olvadáspont |
77℃ |
| Forráspont |
337.7°C at 760 mmHg |
| Törésmutató |
1.578 |
| Gyulladáspont |
158°C |
| Gőznyomás |
0.000103mmHg at 25°C |
| Veszély szimbólumok |
 Xi:Irritant;
|
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
