ChemNet > CAS > 1583-59-1 2,2-Difluoro-1,3-benzodioxole
1583-59-1 2,2-Difluoro-1,3-benzodioxole
termék neve |
2,2-Difluoro-1,3-benzodioxole |
Angol név |
2,2-Difluoro-1,3-benzodioxole; 1,2-[(Difluoromethylene)dioxy]benzene; 2,2-difluorobenzo[d][1,3]dioxole; 2,2-Difluorobenzodioxole; 2,2-Difluoro-2H-1,3-benzodioxole; 2,2-Difluoro-13-benzodioxole |
MF |
C7H4F2O2 |
Molekulatömeg |
158.1023 |
InChI |
InChI=1/C7H4F2O2/c8-7(9)10-5-3-1-2-4-6(5)11-7/h1-4H |
CAS-szám |
1583-59-1 |
EINECS |
216-431-4 |
Molekuláris szerkezete |
|
Sűrűség |
1.42g/cm3 |
Forráspont |
125.1°C at 760 mmHg |
Törésmutató |
1.509 |
Gyulladáspont |
35.1°C |
Gőznyomás |
15mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R10:Flammable.;
R36/38:Irritating to eyes and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|